C6H20N2Si — CID 162130960
N',N'-dimethylbutane-1,4-diamine;silane (PubChem CID 162130960) has the molecular formula C6H20N2Si and a molecular weight of 148.33 g/mol. Its IUPAC name is N',N'-dimethylbutane-1,4-diamine;silane.
| Compound Name | N',N'-dimethylbutane-1,4-diamine;silane |
|---|---|
| PubChem CID | 162130960 |
| Molecular Formula | C6H20N2Si |
| Molecular Weight | 148.33 g/mol |
| Exact Mass | 148.14 |
| IUPAC Name | N',N'-dimethylbutane-1,4-diamine;silane |
| SMILES | CN(C)CCCCN.[SiH4] |
| InChI | InChI=1S/C6H16N2.H4Si/c1-8(2)6-4-3-5-7;/h3-7H2,1-2H3;1H4 |
| InChIKey | ZIQQUUATIGGITI-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.33 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|