C22H50N4S2 — CID 12676116
N'-[2-[2-[8-aminooctyl(methyl)amino]ethyldisulfanyl]ethyl]-N'-methyloctane-1,8-diamine (PubChem CID 12676116) has the molecular formula C22H50N4S2 and a molecular weight of 434.80 g/mol. Its IUPAC name is N'-[2-[2-[8-aminooctyl(methyl)amino]ethyldisulfanyl]ethyl]-N'-methyloctane-1,8-diamine.
| Compound Name | N'-[2-[2-[8-aminooctyl(methyl)amino]ethyldisulfanyl]ethyl]-N'-methyloctane-1,8-diamine |
|---|---|
| PubChem CID | 12676116 |
| Molecular Formula | C22H50N4S2 |
| Molecular Weight | 434.80 g/mol |
| Exact Mass | 434.35 |
| IUPAC Name | N'-[2-[2-[8-aminooctyl(methyl)amino]ethyldisulfanyl]ethyl]-N'-methyloctane-1,8-diamine |
| SMILES | CN(CCCCCCCCN)CCSSCCN(C)CCCCCCCCN |
| InChI | InChI=1S/C22H50N4S2/c1-25(17-13-9-5-3-7-11-15-23)19-21-27-28-22-20-26(2)18-14-10-6-4-8-12-16-24/h3-24H2,1-2H3 |
| InChIKey | TZRWOLSDNWZTSJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.80 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|