C11H26N2S — CID 112660737
N'-methyl-N'-(2-methylsulfanylethyl)heptane-1,7-diamine (PubChem CID 112660737) has the molecular formula C11H26N2S and a molecular weight of 218.41 g/mol. Its IUPAC name is N'-methyl-N'-(2-methylsulfanylethyl)heptane-1,7-diamine.
| Compound Name | N'-methyl-N'-(2-methylsulfanylethyl)heptane-1,7-diamine |
|---|---|
| PubChem CID | 112660737 |
| Molecular Formula | C11H26N2S |
| Molecular Weight | 218.41 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N'-methyl-N'-(2-methylsulfanylethyl)heptane-1,7-diamine |
| SMILES | CSCCN(C)CCCCCCCN |
| InChI | InChI=1S/C11H26N2S/c1-13(10-11-14-2)9-7-5-3-4-6-8-12/h3-12H2,1-2H3 |
| InChIKey | YNLRADAKPIRMNK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|