C11H26N2 — CID 61386627
N-ethyl-N'-methyl-N'-pentylpropane-1,3-diamine (PubChem CID 61386627) has the molecular formula C11H26N2 and a molecular weight of 186.34 g/mol. Its IUPAC name is N-ethyl-N'-methyl-N'-pentylpropane-1,3-diamine.
| Compound Name | N-ethyl-N'-methyl-N'-pentylpropane-1,3-diamine |
|---|---|
| PubChem CID | 61386627 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | N-ethyl-N'-methyl-N'-pentylpropane-1,3-diamine |
| SMILES | CCCCCN(C)CCCNCC |
| InChI | InChI=1S/C11H26N2/c1-4-6-7-10-13(3)11-8-9-12-5-2/h12H,4-11H2,1-3H3 |
| InChIKey | HLRXKDRLILBHQG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|