C13H31N3 — CID 62560197
N',N'-dimethyl-N-[2-[methyl(pentyl)amino]ethyl]propane-1,3-diamine (PubChem CID 62560197) has the molecular formula C13H31N3 and a molecular weight of 229.41 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-[methyl(pentyl)amino]ethyl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[2-[methyl(pentyl)amino]ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 62560197 |
| Molecular Formula | C13H31N3 |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.25 |
| IUPAC Name | N',N'-dimethyl-N-[2-[methyl(pentyl)amino]ethyl]propane-1,3-diamine |
| SMILES | CCCCCN(C)CCNCCCN(C)C |
| InChI | InChI=1S/C13H31N3/c1-5-6-7-12-16(4)13-10-14-9-8-11-15(2)3/h14H,5-13H2,1-4H3 |
| InChIKey | NKGNWPVCUVSWFU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|