C17H38N2 — CID 55195797
N-dodecyl-N',N'-dimethylpropane-1,3-diamine (PubChem CID 55195797) has the molecular formula C17H38N2 and a molecular weight of 270.50 g/mol. Its IUPAC name is N-dodecyl-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-dodecyl-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 55195797 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | N-dodecyl-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CCCCCCCCCCCCNCCCN(C)C |
| InChI | InChI=1S/C17H38N2/c1-4-5-6-7-8-9-10-11-12-13-15-18-16-14-17-19(2)3/h18H,4-17H2,1-3H3 |
| InChIKey | RJQTZOGDLHBTNY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|