C11H28N2 — CID 178117503
N',N'-dimethyl-N-propylbutane-1,4-diamine;ethane (PubChem CID 178117503) has the molecular formula C11H28N2 and a molecular weight of 188.36 g/mol. Its IUPAC name is N',N'-dimethyl-N-propylbutane-1,4-diamine;ethane.
| Compound Name | N',N'-dimethyl-N-propylbutane-1,4-diamine;ethane |
|---|---|
| PubChem CID | 178117503 |
| Molecular Formula | C11H28N2 |
| Molecular Weight | 188.36 g/mol |
| Exact Mass | 188.23 |
| IUPAC Name | N',N'-dimethyl-N-propylbutane-1,4-diamine;ethane |
| SMILES | CC.CCCNCCCCN(C)C |
| InChI | InChI=1S/C9H22N2.C2H6/c1-4-7-10-8-5-6-9-11(2)3;1-2/h10H,4-9H2,1-3H3;1-2H3 |
| InChIKey | RCEPPWAWMWARFM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|