C15H35N3 — CID 57013062
N'-[6-(dimethylamino)hexyl]-N-methylhexane-1,6-diamine (PubChem CID 57013062) has the molecular formula C15H35N3 and a molecular weight of 257.47 g/mol. Its IUPAC name is N'-[6-(dimethylamino)hexyl]-N-methylhexane-1,6-diamine.
| Compound Name | N'-[6-(dimethylamino)hexyl]-N-methylhexane-1,6-diamine |
|---|---|
| PubChem CID | 57013062 |
| Molecular Formula | C15H35N3 |
| Molecular Weight | 257.47 g/mol |
| Exact Mass | 257.28 |
| IUPAC Name | N'-[6-(dimethylamino)hexyl]-N-methylhexane-1,6-diamine |
| SMILES | CNCCCCCCNCCCCCCN(C)C |
| InChI | InChI=1S/C15H35N3/c1-16-12-8-4-5-9-13-17-14-10-6-7-11-15-18(2)3/h16-17H,4-15H2,1-3H3 |
| InChIKey | OPEILFNVZHLMOZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|