C7H20N2O — CID 172587497
methanol;N,N',N'-trimethylpropane-1,3-diamine (PubChem CID 172587497) has the molecular formula C7H20N2O and a molecular weight of 148.25 g/mol. Its IUPAC name is methanol;N,N',N'-trimethylpropane-1,3-diamine.
| Compound Name | methanol;N,N',N'-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 172587497 |
| Molecular Formula | C7H20N2O |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.16 |
| IUPAC Name | methanol;N,N',N'-trimethylpropane-1,3-diamine |
| SMILES | CNCCCN(C)C.CO |
| InChI | InChI=1S/C6H16N2.CH4O/c1-7-5-4-6-8(2)3;1-2/h7H,4-6H2,1-3H3;2H,1H3 |
| InChIKey | CKDOZXXWKVCLEC-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|