C5H15LiN2 — CID 173063979
lithium;hydride;N,N',N'-trimethylethane-1,2-diamine (PubChem CID 173063979) has the molecular formula C5H15LiN2 and a molecular weight of 110.13 g/mol. Its IUPAC name is lithium;hydride;N,N',N'-trimethylethane-1,2-diamine.
| Compound Name | lithium;hydride;N,N',N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 173063979 |
| Molecular Formula | C5H15LiN2 |
| Molecular Weight | 110.13 g/mol |
| Exact Mass | 110.14 |
| IUPAC Name | lithium;hydride;N,N',N'-trimethylethane-1,2-diamine |
| SMILES | CNCCN(C)C.[H-].[Li+] |
| InChI | InChI=1S/C5H14N2.Li.H/c1-6-4-5-7(2)3;;/h6H,4-5H2,1-3H3;;/q;+1;-1 |
| InChIKey | ZGMUQCATSRRCCX-UHFFFAOYSA-N |
| XLogP | -3.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.13 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |