C4H13N2P — CID 129067640
N,N'-dimethyl-N'-phosphanylethane-1,2-diamine (PubChem CID 129067640) has the molecular formula C4H13N2P and a molecular weight of 120.14 g/mol. Its IUPAC name is N,N'-dimethyl-N'-phosphanylethane-1,2-diamine.
| Compound Name | N,N'-dimethyl-N'-phosphanylethane-1,2-diamine |
|---|---|
| PubChem CID | 129067640 |
| Molecular Formula | C4H13N2P |
| Molecular Weight | 120.14 g/mol |
| Exact Mass | 120.08 |
| IUPAC Name | N,N'-dimethyl-N'-phosphanylethane-1,2-diamine |
| SMILES | CNCCN(C)P |
| InChI | InChI=1S/C4H13N2P/c1-5-3-4-6(2)7/h5H,3-4,7H2,1-2H3 |
| InChIKey | DATGLXQVHOOASV-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.14 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|