C6H15IN2 — CID 126702167
N'-iodo-N-methyl-N'-propylethane-1,2-diamine (PubChem CID 126702167) has the molecular formula C6H15IN2 and a molecular weight of 242.10 g/mol. Its IUPAC name is N'-iodo-N-methyl-N'-propylethane-1,2-diamine.
| Compound Name | N'-iodo-N-methyl-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 126702167 |
| Molecular Formula | C6H15IN2 |
| Molecular Weight | 242.10 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | N'-iodo-N-methyl-N'-propylethane-1,2-diamine |
| SMILES | CCCN(I)CCNC |
| InChI | InChI=1S/C6H15IN2/c1-3-5-9(7)6-4-8-2/h8H,3-6H2,1-2H3 |
| InChIKey | LGCLYHODHZGGMA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.10 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|