About N,N'-dimethyl-N'-propylethane-1,2-diamine;methane
N,N'-dimethyl-N'-propylethane-1,2-diamine;methane (PubChem CID 159586340) has the molecular formula C9H26N2
and a molecular weight of 162.32 g/mol. Its IUPAC name is N,N'-dimethyl-N'-propylethane-1,2-diamine;methane.
Analyze N,N'-dimethyl-N'-propylethane-1,2-diamine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dimethyl-N'-propylethane-1,2-diamine;methane?
The IUPAC name of N,N'-dimethyl-N'-propylethane-1,2-diamine;methane (CID 159586340) is N,N'-dimethyl-N'-propylethane-1,2-diamine;methane.
What is the SMILES notation for N,N'-dimethyl-N'-propylethane-1,2-diamine;methane?
The canonical SMILES for N,N'-dimethyl-N'-propylethane-1,2-diamine;methane is C.C.CCCN(C)CCNC.
What is the InChIKey of N,N'-dimethyl-N'-propylethane-1,2-diamine;methane?
The InChIKey is MJQWITDSRLSHBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2.2CH4/c1-4-6-9(3)7-5-8-2;;/h8H,4-7H2,1-3H3;2*1H4.
What are the key properties of N,N'-dimethyl-N'-propylethane-1,2-diamine;methane?
N,N'-dimethyl-N'-propylethane-1,2-diamine;methane has a molecular weight of 162.32 g/mol, XLogP of 1.82, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dimethyl-N'-propylethane-1,2-diamine;methane is sourced from PubChem (CID 159586340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).