C8H22N2 — CID 142961631
N,N'-dimethyl-N'-propylmethanediamine;ethane (PubChem CID 142961631) has the molecular formula C8H22N2 and a molecular weight of 146.28 g/mol. Its IUPAC name is N,N'-dimethyl-N'-propylmethanediamine;ethane.
| Compound Name | N,N'-dimethyl-N'-propylmethanediamine;ethane |
|---|---|
| PubChem CID | 142961631 |
| Molecular Formula | C8H22N2 |
| Molecular Weight | 146.28 g/mol |
| Exact Mass | 146.18 |
| IUPAC Name | N,N'-dimethyl-N'-propylmethanediamine;ethane |
| SMILES | CC.CCCN(C)CNC |
| InChI | InChI=1S/C6H16N2.C2H6/c1-4-5-8(3)6-7-2;1-2/h7H,4-6H2,1-3H3;1-2H3 |
| InChIKey | BQHZDOVRPZMBLB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|