C8H20N2O — CID 143448630
N'-(4-methoxybutyl)-N,N'-dimethylmethanediamine (PubChem CID 143448630) has the molecular formula C8H20N2O and a molecular weight of 160.26 g/mol. Its IUPAC name is N'-(4-methoxybutyl)-N,N'-dimethylmethanediamine.
| Compound Name | N'-(4-methoxybutyl)-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 143448630 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | N'-(4-methoxybutyl)-N,N'-dimethylmethanediamine |
| SMILES | CNCN(C)CCCCOC |
| InChI | InChI=1S/C8H20N2O/c1-9-8-10(2)6-4-5-7-11-3/h9H,4-8H2,1-3H3 |
| InChIKey | AEVVREUWSUGTLJ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|