C16H40N2O2 — CID 177247615
ethane;N-ethyl-N'-(4-methoxybutyl)-N,N'-dimethylethane-1,2-diamine;methoxyethane (PubChem CID 177247615) has the molecular formula C16H40N2O2 and a molecular weight of 292.51 g/mol. Its IUPAC name is ethane;N-ethyl-N'-(4-methoxybutyl)-N,N'-dimethylethane-1,2-diamine;methoxyethane.
| Compound Name | ethane;N-ethyl-N'-(4-methoxybutyl)-N,N'-dimethylethane-1,2-diamine;methoxyethane |
|---|---|
| PubChem CID | 177247615 |
| Molecular Formula | C16H40N2O2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.31 |
| IUPAC Name | ethane;N-ethyl-N'-(4-methoxybutyl)-N,N'-dimethylethane-1,2-diamine;methoxyethane |
| SMILES | CC.CCN(C)CCN(C)CCCCOC.CCOC |
| InChI | InChI=1S/C11H26N2O.C3H8O.C2H6/c1-5-12(2)9-10-13(3)8-6-7-11-14-4;1-3-4-2;1-2/h5-11H2,1-4H3;3H2,1-2H3;1-2H3 |
| InChIKey | RJKKCURLBOYTAI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|