C10H25NO — CID 142226095
N,N-diethyl-3-methoxypropan-1-amine;ethane (PubChem CID 142226095) has the molecular formula C10H25NO and a molecular weight of 175.32 g/mol. Its IUPAC name is N,N-diethyl-3-methoxypropan-1-amine;ethane.
| Compound Name | N,N-diethyl-3-methoxypropan-1-amine;ethane |
|---|---|
| PubChem CID | 142226095 |
| Molecular Formula | C10H25NO |
| Molecular Weight | 175.32 g/mol |
| Exact Mass | 175.19 |
| IUPAC Name | N,N-diethyl-3-methoxypropan-1-amine;ethane |
| SMILES | CC.CCN(CC)CCCOC |
| InChI | InChI=1S/C8H19NO.C2H6/c1-4-9(5-2)7-6-8-10-3;1-2/h4-8H2,1-3H3;1-2H3 |
| InChIKey | ZBBYVOVDMPASHK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|