C10H24N2O — CID 104647419
N'-ethyl-N-(4-methoxybutyl)-N'-methylethane-1,2-diamine (PubChem CID 104647419) has the molecular formula C10H24N2O and a molecular weight of 188.31 g/mol. Its IUPAC name is N'-ethyl-N-(4-methoxybutyl)-N'-methylethane-1,2-diamine.
| Compound Name | N'-ethyl-N-(4-methoxybutyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 104647419 |
| Molecular Formula | C10H24N2O |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | N'-ethyl-N-(4-methoxybutyl)-N'-methylethane-1,2-diamine |
| SMILES | CCN(C)CCNCCCCOC |
| InChI | InChI=1S/C10H24N2O/c1-4-12(2)9-8-11-7-5-6-10-13-3/h11H,4-10H2,1-3H3 |
| InChIKey | CJYNRYJMQLMJMQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|