C13H30N2O — CID 62844812
N-heptyl-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine (PubChem CID 62844812) has the molecular formula C13H30N2O and a molecular weight of 230.40 g/mol. Its IUPAC name is N-heptyl-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine.
| Compound Name | N-heptyl-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 62844812 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | N-heptyl-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
| SMILES | CCCCCCCNCCN(C)CCOC |
| InChI | InChI=1S/C13H30N2O/c1-4-5-6-7-8-9-14-10-11-15(2)12-13-16-3/h14H,4-13H2,1-3H3 |
| InChIKey | POYQXBPTPIPGHQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|