C14H33N3 — CID 63725666
N'-[2-(hexylamino)ethyl]-N,N,N'-trimethylpropane-1,3-diamine (PubChem CID 63725666) has the molecular formula C14H33N3 and a molecular weight of 243.44 g/mol. Its IUPAC name is N'-[2-(hexylamino)ethyl]-N,N,N'-trimethylpropane-1,3-diamine.
| Compound Name | N'-[2-(hexylamino)ethyl]-N,N,N'-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63725666 |
| Molecular Formula | C14H33N3 |
| Molecular Weight | 243.44 g/mol |
| Exact Mass | 243.27 |
| IUPAC Name | N'-[2-(hexylamino)ethyl]-N,N,N'-trimethylpropane-1,3-diamine |
| SMILES | CCCCCCNCCN(C)CCCN(C)C |
| InChI | InChI=1S/C14H33N3/c1-5-6-7-8-10-15-11-14-17(4)13-9-12-16(2)3/h15H,5-14H2,1-4H3 |
| InChIKey | ZWMNAYQAYDEYKC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|