C10H25ClN2 — CID 174617187
N',N'-dimethyl-N-pentylpropane-1,3-diamine;hydrochloride (PubChem CID 174617187) has the molecular formula C10H25ClN2 and a molecular weight of 208.78 g/mol. Its IUPAC name is N',N'-dimethyl-N-pentylpropane-1,3-diamine;hydrochloride.
| Compound Name | N',N'-dimethyl-N-pentylpropane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 174617187 |
| Molecular Formula | C10H25ClN2 |
| Molecular Weight | 208.78 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N',N'-dimethyl-N-pentylpropane-1,3-diamine;hydrochloride |
| SMILES | CCCCCNCCCN(C)C.Cl |
| InChI | InChI=1S/C10H24N2.ClH/c1-4-5-6-8-11-9-7-10-12(2)3;/h11H,4-10H2,1-3H3;1H |
| InChIKey | VVGJNKBTGJYQDY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.78 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|