C11H27N3O — CID 63007801
N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 63007801) has the molecular formula C11H27N3O and a molecular weight of 217.36 g/mol. Its IUPAC name is N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 63007801 |
| Molecular Formula | C11H27N3O |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.22 |
| IUPAC Name | N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | COCCCN(C)CCNCCN(C)C |
| InChI | InChI=1S/C11H27N3O/c1-13(2)9-6-12-7-10-14(3)8-5-11-15-4/h12H,5-11H2,1-4H3 |
| InChIKey | QUYLTZFWWFIWPG-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|