C9H24N4 — CID 134394080
N'-[2-[2-(dimethylamino)ethylamino]ethyl]-N'-methylethane-1,2-diamine (PubChem CID 134394080) has the molecular formula C9H24N4 and a molecular weight of 188.32 g/mol. Its IUPAC name is N'-[2-[2-(dimethylamino)ethylamino]ethyl]-N'-methylethane-1,2-diamine.
| Compound Name | N'-[2-[2-(dimethylamino)ethylamino]ethyl]-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 134394080 |
| Molecular Formula | C9H24N4 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.20 |
| IUPAC Name | N'-[2-[2-(dimethylamino)ethylamino]ethyl]-N'-methylethane-1,2-diamine |
| SMILES | CN(C)CCNCCN(C)CCN |
| InChI | InChI=1S/C9H24N4/c1-12(2)8-5-11-6-9-13(3)7-4-10/h11H,4-10H2,1-3H3 |
| InChIKey | IDRNWHNYQMPHLB-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|