C13H32N4 — CID 169021905
N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine (PubChem CID 169021905) has the molecular formula C13H32N4 and a molecular weight of 244.43 g/mol. Its IUPAC name is N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 169021905 |
| Molecular Formula | C13H32N4 |
| Molecular Weight | 244.43 g/mol |
| Exact Mass | 244.26 |
| IUPAC Name | N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine |
| SMILES | CCCNCCN(CCC)CCN(C)CCN |
| InChI | InChI=1S/C13H32N4/c1-4-7-15-8-11-17(9-5-2)13-12-16(3)10-6-14/h15H,4-14H2,1-3H3 |
| InChIKey | WDZJNWXDPFXZBQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.43 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|