About N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine
N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine (PubChem CID 169021905) has the molecular formula C13H32N4
and a molecular weight of 244.43 g/mol. Its IUPAC name is N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine |
| PubChem CID | 169021905 |
| Molecular Formula | C13H32N4 |
| Molecular Weight | 244.43 g/mol |
| Exact Mass | 244.26 |
| IUPAC Name | N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine |
| SMILES | CCCNCCN(CCC)CCN(C)CCN |
| InChI | InChI=1S/C13H32N4/c1-4-7-15-8-11-17(9-5-2)13-12-16(3)10-6-14/h15H,4-14H2,1-3H3 |
| InChIKey | WDZJNWXDPFXZBQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.43 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine?
The IUPAC name of N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine (CID 169021905) is N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine.
What is the SMILES notation for N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine?
The canonical SMILES for N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine is CCCNCCN(CCC)CCN(C)CCN.
What is the InChIKey of N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine?
The InChIKey is WDZJNWXDPFXZBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H32N4/c1-4-7-15-8-11-17(9-5-2)13-12-16(3)10-6-14/h15H,4-14H2,1-3H3.
What are the key properties of N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine?
N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine has a molecular weight of 244.43 g/mol, XLogP of 0.59, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-[2-[propyl-[2-(propylamino)ethyl]amino]ethyl]ethane-1,2-diamine is sourced from PubChem (CID 169021905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).