C10H26N4 — CID 154558458
N'-[2-[2-[methyl(propyl)amino]ethylamino]ethyl]ethane-1,2-diamine (PubChem CID 154558458) has the molecular formula C10H26N4 and a molecular weight of 202.35 g/mol. Its IUPAC name is N'-[2-[2-[methyl(propyl)amino]ethylamino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[2-[methyl(propyl)amino]ethylamino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 154558458 |
| Molecular Formula | C10H26N4 |
| Molecular Weight | 202.35 g/mol |
| Exact Mass | 202.22 |
| IUPAC Name | N'-[2-[2-[methyl(propyl)amino]ethylamino]ethyl]ethane-1,2-diamine |
| SMILES | CCCN(C)CCNCCNCCN |
| InChI | InChI=1S/C10H26N4/c1-3-9-14(2)10-8-13-7-6-12-5-4-11/h12-13H,3-11H2,1-2H3 |
| InChIKey | NYUTWZWYNIFCMG-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.35 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|