C10H28N2 — CID 164863386
ethane;N'-methyl-N'-propylethane-1,2-diamine (PubChem CID 164863386) has the molecular formula C10H28N2 and a molecular weight of 176.35 g/mol. Its IUPAC name is ethane;N'-methyl-N'-propylethane-1,2-diamine.
| Compound Name | ethane;N'-methyl-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 164863386 |
| Molecular Formula | C10H28N2 |
| Molecular Weight | 176.35 g/mol |
| Exact Mass | 176.23 |
| IUPAC Name | ethane;N'-methyl-N'-propylethane-1,2-diamine |
| SMILES | CC.CC.CCCN(C)CCN |
| InChI | InChI=1S/C6H16N2.2C2H6/c1-3-5-8(2)6-4-7;2*1-2/h3-7H2,1-2H3;2*1-2H3 |
| InChIKey | QYLNFCYQIYXNFF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |