C5H13I2N3 — CID 145464641
N'-[2-(diiodoamino)ethyl]-N'-methylethane-1,2-diamine (PubChem CID 145464641) has the molecular formula C5H13I2N3 and a molecular weight of 368.99 g/mol. Its IUPAC name is N'-[2-(diiodoamino)ethyl]-N'-methylethane-1,2-diamine.
| Compound Name | N'-[2-(diiodoamino)ethyl]-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 145464641 |
| Molecular Formula | C5H13I2N3 |
| Molecular Weight | 368.99 g/mol |
| Exact Mass | 368.92 |
| IUPAC Name | N'-[2-(diiodoamino)ethyl]-N'-methylethane-1,2-diamine |
| SMILES | CN(CCN)CCN(I)I |
| InChI | InChI=1S/C5H13I2N3/c1-9(3-2-8)4-5-10(6)7/h2-5,8H2,1H3 |
| InChIKey | OVZPYHUQPBURGS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.99 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|