C7H14N2 — CID 62686258
N'-but-3-ynyl-N'-methylethane-1,2-diamine (PubChem CID 62686258) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is N'-but-3-ynyl-N'-methylethane-1,2-diamine.
| Compound Name | N'-but-3-ynyl-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 62686258 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | N'-but-3-ynyl-N'-methylethane-1,2-diamine |
| SMILES | C#CCCN(C)CCN |
| InChI | InChI=1S/C7H14N2/c1-3-4-6-9(2)7-5-8/h1H,4-8H2,2H3 |
| InChIKey | BHQGRDXLVIXEFR-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|