C8H16N2 — CID 130563525
1-N-but-3-ynyl-1-N-methylpropane-1,2-diamine (PubChem CID 130563525) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 1-N-but-3-ynyl-1-N-methylpropane-1,2-diamine.
| Compound Name | 1-N-but-3-ynyl-1-N-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 130563525 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 1-N-but-3-ynyl-1-N-methylpropane-1,2-diamine |
| SMILES | C#CCCN(C)CC(C)N |
| InChI | InChI=1S/C8H16N2/c1-4-5-6-10(3)7-8(2)9/h1,8H,5-7,9H2,2-3H3 |
| InChIKey | JNEYVFNJMNJBCM-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|