C8H17N — CID 142119055
N,N-dimethylbut-3-yn-1-amine;ethane (PubChem CID 142119055) has the molecular formula C8H17N and a molecular weight of 127.23 g/mol. Its IUPAC name is N,N-dimethylbut-3-yn-1-amine;ethane.
| Compound Name | N,N-dimethylbut-3-yn-1-amine;ethane |
|---|---|
| PubChem CID | 142119055 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | N,N-dimethylbut-3-yn-1-amine;ethane |
| SMILES | C#CCCN(C)C.CC |
| InChI | InChI=1S/C6H11N.C2H6/c1-4-5-6-7(2)3;1-2/h1H,5-6H2,2-3H3;1-2H3 |
| InChIKey | ISDMMAYNWNJHNC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|