C13H26N2 — CID 102996136
N'-but-3-ynyl-N,N,N'-triethylpropane-1,3-diamine (PubChem CID 102996136) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is N'-but-3-ynyl-N,N,N'-triethylpropane-1,3-diamine.
| Compound Name | N'-but-3-ynyl-N,N,N'-triethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 102996136 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | N'-but-3-ynyl-N,N,N'-triethylpropane-1,3-diamine |
| SMILES | C#CCCN(CC)CCCN(CC)CC |
| InChI | InChI=1S/C13H26N2/c1-5-9-11-15(8-4)13-10-12-14(6-2)7-3/h1H,6-13H2,2-4H3 |
| InChIKey | URQGXUTWALMUDT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|