C13H30N4O2 — CID 129181222
methyl 3-[2-[2-[2-aminoethyl(methyl)amino]ethyl-ethylamino]ethylamino]propanoate (PubChem CID 129181222) has the molecular formula C13H30N4O2 and a molecular weight of 274.41 g/mol. Its IUPAC name is methyl 3-[2-[2-[2-aminoethyl(methyl)amino]ethyl-ethylamino]ethylamino]propanoate.
| Compound Name | methyl 3-[2-[2-[2-aminoethyl(methyl)amino]ethyl-ethylamino]ethylamino]propanoate |
|---|---|
| PubChem CID | 129181222 |
| Molecular Formula | C13H30N4O2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | methyl 3-[2-[2-[2-aminoethyl(methyl)amino]ethyl-ethylamino]ethylamino]propanoate |
| SMILES | CCN(CCNCCC(=O)OC)CCN(C)CCN |
| InChI | InChI=1S/C13H30N4O2/c1-4-17(12-11-16(2)9-6-14)10-8-15-7-5-13(18)19-3/h15H,4-12,14H2,1-3H3 |
| InChIKey | ACLRZUTWYZAPOW-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|