C16H34N4O4 — CID 143379175
ethyl 3-[2-[2-[2-aminoethyl-(3-ethoxy-3-oxopropyl)amino]ethylamino]ethylamino]propanoate (PubChem CID 143379175) has the molecular formula C16H34N4O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is ethyl 3-[2-[2-[2-aminoethyl-(3-ethoxy-3-oxopropyl)amino]ethylamino]ethylamino]propanoate.
| Compound Name | ethyl 3-[2-[2-[2-aminoethyl-(3-ethoxy-3-oxopropyl)amino]ethylamino]ethylamino]propanoate |
|---|---|
| PubChem CID | 143379175 |
| Molecular Formula | C16H34N4O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | ethyl 3-[2-[2-[2-aminoethyl-(3-ethoxy-3-oxopropyl)amino]ethylamino]ethylamino]propanoate |
| SMILES | CCOC(=O)CCNCCNCCN(CCN)CCC(=O)OCC |
| InChI | InChI=1S/C16H34N4O4/c1-3-23-15(21)5-8-18-9-10-19-11-14-20(13-7-17)12-6-16(22)24-4-2/h18-19H,3-14,17H2,1-2H3 |
| InChIKey | QKRQWEUMIPQKIE-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|