C19H37N3O6 — CID 118011739
methyl 3-[2-[(3-methoxy-3-oxopropyl)-[2-[(3-methoxy-3-oxopropyl)-propylamino]ethyl]amino]ethylamino]propanoate (PubChem CID 118011739) has the molecular formula C19H37N3O6 and a molecular weight of 403.52 g/mol. Its IUPAC name is methyl 3-[2-[(3-methoxy-3-oxopropyl)-[2-[(3-methoxy-3-oxopropyl)-propylamino]ethyl]amino]ethylamino]propanoate.
| Compound Name | methyl 3-[2-[(3-methoxy-3-oxopropyl)-[2-[(3-methoxy-3-oxopropyl)-propylamino]ethyl]amino]ethylamino]propanoate |
|---|---|
| PubChem CID | 118011739 |
| Molecular Formula | C19H37N3O6 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | methyl 3-[2-[(3-methoxy-3-oxopropyl)-[2-[(3-methoxy-3-oxopropyl)-propylamino]ethyl]amino]ethylamino]propanoate |
| SMILES | CCCN(CCC(=O)OC)CCN(CCNCCC(=O)OC)CCC(=O)OC |
| InChI | InChI=1S/C19H37N3O6/c1-5-11-21(12-7-18(24)27-3)15-16-22(13-8-19(25)28-4)14-10-20-9-6-17(23)26-2/h20H,5-16H2,1-4H3 |
| InChIKey | CDMFJVKGRZXCQB-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|