C24H48N4O6 — CID 90207729
methyl 3-[2-[2-[2-[bis(3-methoxy-3-oxopropyl)amino]ethyl-pentylamino]ethyl-methylamino]ethylamino]propanoate (PubChem CID 90207729) has the molecular formula C24H48N4O6 and a molecular weight of 488.67 g/mol. Its IUPAC name is methyl 3-[2-[2-[2-[bis(3-methoxy-3-oxopropyl)amino]ethyl-pentylamino]ethyl-methylamino]ethylamino]propanoate.
| Compound Name | methyl 3-[2-[2-[2-[bis(3-methoxy-3-oxopropyl)amino]ethyl-pentylamino]ethyl-methylamino]ethylamino]propanoate |
|---|---|
| PubChem CID | 90207729 |
| Molecular Formula | C24H48N4O6 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.36 |
| IUPAC Name | methyl 3-[2-[2-[2-[bis(3-methoxy-3-oxopropyl)amino]ethyl-pentylamino]ethyl-methylamino]ethylamino]propanoate |
| SMILES | CCCCCN(CCN(C)CCNCCC(=O)OC)CCN(CCC(=O)OC)CCC(=O)OC |
| InChI | InChI=1S/C24H48N4O6/c1-6-7-8-14-27(19-18-26(2)17-13-25-12-9-22(29)32-3)20-21-28(15-10-23(30)33-4)16-11-24(31)34-5/h25H,6-21H2,1-5H3 |
| InChIKey | KJWQFDJPACFDFT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|