C16H33NO2 — CID 11032971
methyl 3-(dihexylamino)propanoate (PubChem CID 11032971) has the molecular formula C16H33NO2 and a molecular weight of 271.44 g/mol. Its IUPAC name is methyl 3-(dihexylamino)propanoate.
| Compound Name | methyl 3-(dihexylamino)propanoate |
|---|---|
| PubChem CID | 11032971 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | methyl 3-(dihexylamino)propanoate |
| SMILES | CCCCCCN(CCCCCC)CCC(=O)OC |
| InChI | InChI=1S/C16H33NO2/c1-4-6-8-10-13-17(14-11-9-7-5-2)15-12-16(18)19-3/h4-15H2,1-3H3 |
| InChIKey | HBJBMQUMMMTASV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|