C40H84N6O8 — CID 157083550
methyl 3-[2-aminoethyl(hexyl)amino]propanoate;methyl 6-(5-aminopentylamino)hexanoate;methyl 6-[5-[(3-methoxy-3-oxopropyl)amino]pentylamino]hexanoate (PubChem CID 157083550) has the molecular formula C40H84N6O8 and a molecular weight of 777.15 g/mol. Its IUPAC name is methyl 3-[2-aminoethyl(hexyl)amino]propanoate;methyl 6-(5-aminopentylamino)hexanoate;methyl 6-[5-[(3-methoxy-3-oxopropyl)amino]pentylamino]hexanoate.
| Compound Name | methyl 3-[2-aminoethyl(hexyl)amino]propanoate;methyl 6-(5-aminopentylamino)hexanoate;methyl 6-[5-[(3-methoxy-3-oxopropyl)amino]pentylamino]hexanoate |
|---|---|
| PubChem CID | 157083550 |
| Molecular Formula | C40H84N6O8 |
| Molecular Weight | 777.15 g/mol |
| Exact Mass | 776.64 |
| IUPAC Name | methyl 3-[2-aminoethyl(hexyl)amino]propanoate;methyl 6-(5-aminopentylamino)hexanoate;methyl 6-[5-[(3-methoxy-3-oxopropyl)amino]pentylamino]hexanoate |
| SMILES | CCCCCCN(CCN)CCC(=O)OC.COC(=O)CCCCCNCCCCCN.COC(=O)CCCCCNCCCCCNCCC(=O)OC |
| InChI | InChI=1S/C16H32N2O4.2C12H26N2O2/c1-21-15(19)9-5-3-6-11-17-12-7-4-8-13-18-14-10-16(20)22-2;1-16-12(15)8-4-2-6-10-14-11-7-3-5-9-13;1-3-4-5-6-9-14(11-8-13)10-7-12(15)16-2/h17-18H,3-14H2,1-2H3;14H,2-11,13H2,1H3;3-11,13H2,1-2H3 |
| InChIKey | ADVGNNMYFPYMKH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 196.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.15 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|