C10H24N4O2 — CID 102046536
methyl 3-[2-[bis(2-aminoethyl)amino]ethylamino]propanoate (PubChem CID 102046536) has the molecular formula C10H24N4O2 and a molecular weight of 232.33 g/mol. Its IUPAC name is methyl 3-[2-[bis(2-aminoethyl)amino]ethylamino]propanoate.
| Compound Name | methyl 3-[2-[bis(2-aminoethyl)amino]ethylamino]propanoate |
|---|---|
| PubChem CID | 102046536 |
| Molecular Formula | C10H24N4O2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | methyl 3-[2-[bis(2-aminoethyl)amino]ethylamino]propanoate |
| SMILES | COC(=O)CCNCCN(CCN)CCN |
| InChI | InChI=1S/C10H24N4O2/c1-16-10(15)2-5-13-6-9-14(7-3-11)8-4-12/h13H,2-9,11-12H2,1H3 |
| InChIKey | JQIGKJCBZHDIQD-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|