C14H33N3O8 — CID 173116618
acetic acid;2-[2-[2-aminoethyl(2-hydroxyethyl)amino]ethylamino]ethanol (PubChem CID 173116618) has the molecular formula C14H33N3O8 and a molecular weight of 371.43 g/mol. Its IUPAC name is acetic acid;2-[2-[2-aminoethyl(2-hydroxyethyl)amino]ethylamino]ethanol.
| Compound Name | acetic acid;2-[2-[2-aminoethyl(2-hydroxyethyl)amino]ethylamino]ethanol |
|---|---|
| PubChem CID | 173116618 |
| Molecular Formula | C14H33N3O8 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | acetic acid;2-[2-[2-aminoethyl(2-hydroxyethyl)amino]ethylamino]ethanol |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)O.NCCN(CCO)CCNCCO |
| InChI | InChI=1S/C8H21N3O2.3C2H4O2/c9-1-4-11(6-8-13)5-2-10-3-7-12;3*1-2(3)4/h10,12-13H,1-9H2;3*1H3,(H,3,4) |
| InChIKey | QBPMAESAZVZKSK-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 193.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|