About 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-(2-hydroxyethylamino)ethanol
2-[ethyl(2-hydroxyethyl)amino]ethanol;2-(2-hydroxyethylamino)ethanol (PubChem CID 159800308) has the molecular formula C10H26N2O4
and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-(2-hydroxyethylamino)ethanol.
Molecular Properties
| Compound Name | 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-(2-hydroxyethylamino)ethanol |
| PubChem CID | 159800308 |
| Molecular Formula | C10H26N2O4 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-(2-hydroxyethylamino)ethanol |
| SMILES | CCN(CCO)CCO.OCCNCCO |
| InChI | InChI=1S/C6H15NO2.C4H11NO2/c1-2-7(3-5-8)4-6-9;6-3-1-5-2-4-7/h8-9H,2-6H2,1H3;5-7H,1-4H2 |
| InChIKey | NJRWIKSNQMYALF-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-(2-hydroxyethylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-(2-hydroxyethylamino)ethanol?
The IUPAC name of 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-(2-hydroxyethylamino)ethanol (CID 159800308) is 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-(2-hydroxyethylamino)ethanol.
What is the SMILES notation for 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-(2-hydroxyethylamino)ethanol?
The canonical SMILES for 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-(2-hydroxyethylamino)ethanol is CCN(CCO)CCO.OCCNCCO.
What is the InChIKey of 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-(2-hydroxyethylamino)ethanol?
The InChIKey is NJRWIKSNQMYALF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO2.C4H11NO2/c1-2-7(3-5-8)4-6-9;6-3-1-5-2-4-7/h8-9H,2-6H2,1H3;5-7H,1-4H2.
What are the key properties of 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-(2-hydroxyethylamino)ethanol?
2-[ethyl(2-hydroxyethyl)amino]ethanol;2-(2-hydroxyethylamino)ethanol has a molecular weight of 238.33 g/mol, XLogP of -2.15, 9 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-(2-hydroxyethylamino)ethanol is sourced from PubChem (CID 159800308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).