About 2-(2-aminoethylamino)ethanol;2-[bis(2-hydroxyethyl)amino]ethanol
2-(2-aminoethylamino)ethanol;2-[bis(2-hydroxyethyl)amino]ethanol (PubChem CID 161491174) has the molecular formula C10H27N3O4
and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-(2-aminoethylamino)ethanol;2-[bis(2-hydroxyethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-(2-aminoethylamino)ethanol;2-[bis(2-hydroxyethyl)amino]ethanol |
| PubChem CID | 161491174 |
| Molecular Formula | C10H27N3O4 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 2-(2-aminoethylamino)ethanol;2-[bis(2-hydroxyethyl)amino]ethanol |
| SMILES | NCCNCCO.OCCN(CCO)CCO |
| InChI | InChI=1S/C6H15NO3.C4H12N2O/c8-4-1-7(2-5-9)3-6-10;5-1-2-6-3-4-7/h8-10H,1-6H2;6-7H,1-5H2 |
| InChIKey | WFPZIINOVNWKHW-UHFFFAOYSA-N |
| XLogP | -3.21 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoethylamino)ethanol;2-[bis(2-hydroxyethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethylamino)ethanol;2-[bis(2-hydroxyethyl)amino]ethanol?
The IUPAC name of 2-(2-aminoethylamino)ethanol;2-[bis(2-hydroxyethyl)amino]ethanol (CID 161491174) is 2-(2-aminoethylamino)ethanol;2-[bis(2-hydroxyethyl)amino]ethanol.
What is the SMILES notation for 2-(2-aminoethylamino)ethanol;2-[bis(2-hydroxyethyl)amino]ethanol?
The canonical SMILES for 2-(2-aminoethylamino)ethanol;2-[bis(2-hydroxyethyl)amino]ethanol is NCCNCCO.OCCN(CCO)CCO.
What is the InChIKey of 2-(2-aminoethylamino)ethanol;2-[bis(2-hydroxyethyl)amino]ethanol?
The InChIKey is WFPZIINOVNWKHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.C4H12N2O/c8-4-1-7(2-5-9)3-6-10;5-1-2-6-3-4-7/h8-10H,1-6H2;6-7H,1-5H2.
What are the key properties of 2-(2-aminoethylamino)ethanol;2-[bis(2-hydroxyethyl)amino]ethanol?
2-(2-aminoethylamino)ethanol;2-[bis(2-hydroxyethyl)amino]ethanol has a molecular weight of 253.34 g/mol, XLogP of -3.21, 10 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethylamino)ethanol;2-[bis(2-hydroxyethyl)amino]ethanol is sourced from PubChem (CID 161491174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).