C12H32N4O2 — CID 90906484
2-[2-[2-aminoethyl-[2-(hydroxymethylamino)ethyl]amino]ethylamino]ethanol;propane (PubChem CID 90906484) has the molecular formula C12H32N4O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-[2-[2-aminoethyl-[2-(hydroxymethylamino)ethyl]amino]ethylamino]ethanol;propane.
| Compound Name | 2-[2-[2-aminoethyl-[2-(hydroxymethylamino)ethyl]amino]ethylamino]ethanol;propane |
|---|---|
| PubChem CID | 90906484 |
| Molecular Formula | C12H32N4O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | 2-[2-[2-aminoethyl-[2-(hydroxymethylamino)ethyl]amino]ethylamino]ethanol;propane |
| SMILES | CCC.NCCN(CCNCO)CCNCCO |
| InChI | InChI=1S/C9H24N4O2.C3H8/c10-1-5-13(7-3-12-9-15)6-2-11-4-8-14;1-3-2/h11-12,14-15H,1-10H2;3H2,1-2H3 |
| InChIKey | FHQVWAHUBOEEAL-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|