acetic acid;2-[2-aminoethyl(2-hydroxyethyl)amino]ethanol

C10H24N2O6 — CID 88745312

IUPACacetic acid;2-[2-aminoethyl(2-hydroxyethyl)amino]ethanol
SMILESCC(=O)O.CC(=O)O.NCCN(CCO)CCO
InChIInChI=1S/C6H16N2O2.2C2H4O2/c7-1-2-8(3-5-9)4-6-10;2*1-2(3)4/h9-10H,1-7H2;2*1H3,(H,3,4)
InChIKeyBXYYONNUYDIJFK-UHFFFAOYSA-N
MW268.31 g/mol
LogP-1.59
Rot. Bonds6

About acetic acid;2-[2-aminoethyl(2-hydroxyethyl)amino]ethanol

acetic acid;2-[2-aminoethyl(2-hydroxyethyl)amino]ethanol (PubChem CID 88745312) has the molecular formula C10H24N2O6 and a molecular weight of 268.31 g/mol. Its IUPAC name is acetic acid;2-[2-aminoethyl(2-hydroxyethyl)amino]ethanol.

Molecular Properties

Compound Nameacetic acid;2-[2-aminoethyl(2-hydroxyethyl)amino]ethanol
PubChem CID88745312
Molecular FormulaC10H24N2O6
Molecular Weight268.31 g/mol
Exact Mass268.16
IUPAC Nameacetic acid;2-[2-aminoethyl(2-hydroxyethyl)amino]ethanol
SMILESCC(=O)O.CC(=O)O.NCCN(CCO)CCO
InChIInChI=1S/C6H16N2O2.2C2H4O2/c7-1-2-8(3-5-9)4-6-10;2*1-2(3)4/h9-10H,1-7H2;2*1H3,(H,3,4)
InChIKeyBXYYONNUYDIJFK-UHFFFAOYSA-N
XLogP-1.59
TPSA144.32 Ų
H-Bond Donors5
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.31
LogP ≤ 5-1.59
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 106

Analyze acetic acid;2-[2-aminoethyl(2-hydroxyethyl)amino]ethanol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;2-[2-aminoethyl(2-hydroxyethyl)amino]ethanol?
The IUPAC name of acetic acid;2-[2-aminoethyl(2-hydroxyethyl)amino]ethanol (CID 88745312) is acetic acid;2-[2-aminoethyl(2-hydroxyethyl)amino]ethanol.
What is the SMILES notation for acetic acid;2-[2-aminoethyl(2-hydroxyethyl)amino]ethanol?
The canonical SMILES for acetic acid;2-[2-aminoethyl(2-hydroxyethyl)amino]ethanol is CC(=O)O.CC(=O)O.NCCN(CCO)CCO.
What is the InChIKey of acetic acid;2-[2-aminoethyl(2-hydroxyethyl)amino]ethanol?
The InChIKey is BXYYONNUYDIJFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2O2.2C2H4O2/c7-1-2-8(3-5-9)4-6-10;2*1-2(3)4/h9-10H,1-7H2;2*1H3,(H,3,4).
What are the key properties of acetic acid;2-[2-aminoethyl(2-hydroxyethyl)amino]ethanol?
acetic acid;2-[2-aminoethyl(2-hydroxyethyl)amino]ethanol has a molecular weight of 268.31 g/mol, XLogP of -1.59, 6 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-[2-aminoethyl(2-hydroxyethyl)amino]ethanol is sourced from PubChem (CID 88745312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).