C14H27NO7 — CID 174712739
2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-but-2-enedioic acid;2-methylprop-1-ene (PubChem CID 174712739) has the molecular formula C14H27NO7 and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-but-2-enedioic acid;2-methylprop-1-ene.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-but-2-enedioic acid;2-methylprop-1-ene |
|---|---|
| PubChem CID | 174712739 |
| Molecular Formula | C14H27NO7 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-but-2-enedioic acid;2-methylprop-1-ene |
| SMILES | C=C(C)C.O=C(O)/C=C\C(=O)O.OCCN(CCO)CCO |
| InChI | InChI=1S/C6H15NO3.C4H4O4.C4H8/c8-4-1-7(2-5-9)3-6-10;5-3(6)1-2-4(7)8;1-4(2)3/h8-10H,1-6H2;1-2H,(H,5,6)(H,7,8);1H2,2-3H3/b;2-1-; |
| InChIKey | DHDVSTDHUUMLDT-FJOGWHKWSA-N |
| XLogP | -0.44 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|