C9H17NO4 — CID 77005970
4-[bis(2-hydroxyethyl)amino]-3-methylbut-2-enoic acid (PubChem CID 77005970) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is 4-[bis(2-hydroxyethyl)amino]-3-methylbut-2-enoic acid.
| Compound Name | 4-[bis(2-hydroxyethyl)amino]-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 77005970 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 4-[bis(2-hydroxyethyl)amino]-3-methylbut-2-enoic acid |
| SMILES | CC(=CC(=O)O)CN(CCO)CCO |
| InChI | InChI=1S/C9H17NO4/c1-8(6-9(13)14)7-10(2-4-11)3-5-12/h6,11-12H,2-5,7H2,1H3,(H,13,14) |
| InChIKey | ZFVXERPFUGMQPJ-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|