C11H17NO4 — CID 129147798
2-[carboxymethyl-[(2E)-2,4-dimethylpenta-2,4-dienyl]amino]acetic acid (PubChem CID 129147798) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-[carboxymethyl-[(2E)-2,4-dimethylpenta-2,4-dienyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[(2E)-2,4-dimethylpenta-2,4-dienyl]amino]acetic acid |
|---|---|
| PubChem CID | 129147798 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-[carboxymethyl-[(2E)-2,4-dimethylpenta-2,4-dienyl]amino]acetic acid |
| SMILES | C=C(C)/C=C(\C)CN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C11H17NO4/c1-8(2)4-9(3)5-12(6-10(13)14)7-11(15)16/h4H,1,5-7H2,2-3H3,(H,13,14)(H,15,16)/b9-4+ |
| InChIKey | SRKDZDPDOLZWFZ-RUDMXATFSA-N |
| XLogP | 0.98 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|