C25H28N2O8 — CID 135268304
2-[[(2E,4E)-6-[[bis(carboxymethyl)amino]methyl]-2-methyl-4-(2-phenylethynyl)hepta-2,4,6-trienyl]-(carboxymethyl)amino]acetic acid (PubChem CID 135268304) has the molecular formula C25H28N2O8 and a molecular weight of 484.51 g/mol. Its IUPAC name is 2-[[(2E,4E)-6-[[bis(carboxymethyl)amino]methyl]-2-methyl-4-(2-phenylethynyl)hepta-2,4,6-trienyl]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[(2E,4E)-6-[[bis(carboxymethyl)amino]methyl]-2-methyl-4-(2-phenylethynyl)hepta-2,4,6-trienyl]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 135268304 |
| Molecular Formula | C25H28N2O8 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 2-[[(2E,4E)-6-[[bis(carboxymethyl)amino]methyl]-2-methyl-4-(2-phenylethynyl)hepta-2,4,6-trienyl]-(carboxymethyl)amino]acetic acid |
| SMILES | C=C(/C=C(C#Cc1ccccc1)\C=C(/C)CN(CC(=O)O)CC(=O)O)CN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C25H28N2O8/c1-18(12-26(14-22(28)29)15-23(30)31)10-21(9-8-20-6-4-3-5-7-20)11-19(2)13-27(16-24(32)33)17-25(34)35/h3-7,10-11H,1,12-17H2,2H3,(H,28,29)(H,30,31)(H,32,33)(H,34,35)/b19-11+,21-10- |
| InChIKey | UZIYBNTZHOLPQX-PICJNDGXSA-N |
| XLogP | 1.41 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|