About palladium;bis(3-phenylprop-2-ynoic acid)
palladium;bis(3-phenylprop-2-ynoic acid) (PubChem CID 139238294) has the molecular formula C18H12O4Pd
and a molecular weight of 398.71 g/mol. Its IUPAC name is palladium;bis(3-phenylprop-2-ynoic acid).
Molecular Properties
| Compound Name | palladium;bis(3-phenylprop-2-ynoic acid) |
| PubChem CID | 139238294 |
| Molecular Formula | C18H12O4Pd |
| Molecular Weight | 398.71 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | palladium;bis(3-phenylprop-2-ynoic acid) |
| SMILES | O=C(O)C#Cc1ccccc1.O=C(O)C#Cc1ccccc1.[Pd] |
| InChI | InChI=1S/2C9H6O2.Pd/c2*10-9(11)7-6-8-4-2-1-3-5-8;/h2*1-5H,(H,10,11); |
| InChIKey | ITSCYFWFTICMAF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.71 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze palladium;bis(3-phenylprop-2-ynoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium;bis(3-phenylprop-2-ynoic acid)?
The IUPAC name of palladium;bis(3-phenylprop-2-ynoic acid) (CID 139238294) is palladium;bis(3-phenylprop-2-ynoic acid).
What is the SMILES notation for palladium;bis(3-phenylprop-2-ynoic acid)?
The canonical SMILES for palladium;bis(3-phenylprop-2-ynoic acid) is O=C(O)C#Cc1ccccc1.O=C(O)C#Cc1ccccc1.[Pd].
What is the InChIKey of palladium;bis(3-phenylprop-2-ynoic acid)?
The InChIKey is ITSCYFWFTICMAF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H6O2.Pd/c2*10-9(11)7-6-8-4-2-1-3-5-8;/h2*1-5H,(H,10,11);.
What are the key properties of palladium;bis(3-phenylprop-2-ynoic acid)?
palladium;bis(3-phenylprop-2-ynoic acid) has a molecular weight of 398.71 g/mol, XLogP of 2.24, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for palladium;bis(3-phenylprop-2-ynoic acid) is sourced from PubChem (CID 139238294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).