About 4-phenylbut-2-ynoic acid
4-phenylbut-2-ynoic acid (PubChem CID 22023702) has the molecular formula C10H8O2
and a molecular weight of 160.17 g/mol. Its IUPAC name is 4-phenylbut-2-ynoic acid.
Molecular Properties
| Compound Name | 4-phenylbut-2-ynoic acid |
| PubChem CID | 22023702 |
| Molecular Formula | C10H8O2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 4-phenylbut-2-ynoic acid |
| SMILES | O=C(O)C#CCc1ccccc1 |
| InChI | InChI=1S/C10H8O2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,7H2,(H,11,12) |
| InChIKey | NLLHCIHZTNNJFJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylbut-2-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylbut-2-ynoic acid?
The IUPAC name of 4-phenylbut-2-ynoic acid (CID 22023702) is 4-phenylbut-2-ynoic acid.
What is the SMILES notation for 4-phenylbut-2-ynoic acid?
The canonical SMILES for 4-phenylbut-2-ynoic acid is O=C(O)C#CCc1ccccc1.
What is the InChIKey of 4-phenylbut-2-ynoic acid?
The InChIKey is NLLHCIHZTNNJFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,7H2,(H,11,12).
What are the key properties of 4-phenylbut-2-ynoic acid?
4-phenylbut-2-ynoic acid has a molecular weight of 160.17 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylbut-2-ynoic acid is sourced from PubChem (CID 22023702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).