5-(2,5-dioxopyrrolidin-1-yl)-6-phenylhex-2-ynoic acid

C16H15NO4 — CID 145184600

IUPAC5-(2,5-dioxopyrrolidin-1-yl)-6-phenylhex-2-ynoic acid
SMILESO=C(O)C#CCC(Cc1ccccc1)N1C(=O)CCC1=O
InChIInChI=1S/C16H15NO4/c18-14-9-10-15(19)17(14)13(7-4-8-16(20)21)11-12-5-2-1-3-6-12/h1-3,5-6,13H,7,9-11H2,(H,20,21)
InChIKeyLMOLTZSFTNFBGB-UHFFFAOYSA-N
MW285.30 g/mol
LogP1.22
Rot. Bonds4

About 5-(2,5-dioxopyrrolidin-1-yl)-6-phenylhex-2-ynoic acid

5-(2,5-dioxopyrrolidin-1-yl)-6-phenylhex-2-ynoic acid (PubChem CID 145184600) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is 5-(2,5-dioxopyrrolidin-1-yl)-6-phenylhex-2-ynoic acid.

Molecular Properties

Compound Name5-(2,5-dioxopyrrolidin-1-yl)-6-phenylhex-2-ynoic acid
PubChem CID145184600
Molecular FormulaC16H15NO4
Molecular Weight285.30 g/mol
Exact Mass285.10
IUPAC Name5-(2,5-dioxopyrrolidin-1-yl)-6-phenylhex-2-ynoic acid
SMILESO=C(O)C#CCC(Cc1ccccc1)N1C(=O)CCC1=O
InChIInChI=1S/C16H15NO4/c18-14-9-10-15(19)17(14)13(7-4-8-16(20)21)11-12-5-2-1-3-6-12/h1-3,5-6,13H,7,9-11H2,(H,20,21)
InChIKeyLMOLTZSFTNFBGB-UHFFFAOYSA-N
XLogP1.22
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.30
LogP ≤ 51.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 5-(2,5-dioxopyrrolidin-1-yl)-6-phenylhex-2-ynoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,5-dioxopyrrolidin-1-yl)-6-phenylhex-2-ynoic acid?
The IUPAC name of 5-(2,5-dioxopyrrolidin-1-yl)-6-phenylhex-2-ynoic acid (CID 145184600) is 5-(2,5-dioxopyrrolidin-1-yl)-6-phenylhex-2-ynoic acid.
What is the SMILES notation for 5-(2,5-dioxopyrrolidin-1-yl)-6-phenylhex-2-ynoic acid?
The canonical SMILES for 5-(2,5-dioxopyrrolidin-1-yl)-6-phenylhex-2-ynoic acid is O=C(O)C#CCC(Cc1ccccc1)N1C(=O)CCC1=O.
What is the InChIKey of 5-(2,5-dioxopyrrolidin-1-yl)-6-phenylhex-2-ynoic acid?
The InChIKey is LMOLTZSFTNFBGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO4/c18-14-9-10-15(19)17(14)13(7-4-8-16(20)21)11-12-5-2-1-3-6-12/h1-3,5-6,13H,7,9-11H2,(H,20,21).
What are the key properties of 5-(2,5-dioxopyrrolidin-1-yl)-6-phenylhex-2-ynoic acid?
5-(2,5-dioxopyrrolidin-1-yl)-6-phenylhex-2-ynoic acid has a molecular weight of 285.30 g/mol, XLogP of 1.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dioxopyrrolidin-1-yl)-6-phenylhex-2-ynoic acid is sourced from PubChem (CID 145184600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).